CAS 80364-90-5
:3-chloro-N-(1-phenylethyl)propanamide
Description:
3-Chloro-N-(1-phenylethyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chloro substituent on the third carbon of the propanamide chain contributes to its reactivity and potential applications in organic synthesis. The N-(1-phenylethyl) group indicates that the nitrogen atom is bonded to a phenylethyl moiety, which adds steric bulk and can influence the compound's biological activity and solubility. This compound is likely to be a solid at room temperature, with moderate polarity due to the amide and chloro groups, affecting its solubility in various solvents. Its structure suggests potential uses in pharmaceuticals or as an intermediate in chemical synthesis, particularly in the development of compounds with specific biological activities. Safety data should be consulted for handling, as the presence of chlorine may pose hazards. Overall, 3-chloro-N-(1-phenylethyl)propanamide exemplifies the complexity and utility of halogenated amides in organic chemistry.
Formula:C11H14ClNO
InChI:InChI=1/C11H14ClNO/c1-9(13-11(14)7-8-12)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,14)
SMILES:CC(c1ccccc1)N=C(CCCl)O
Synonyms:- propanamide, 3-chloro-N-(1-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
