CAS 80365-01-1

1-(2-ethoxy-3-methoxyphenyl)methanamine

Description:

1-(2-Ethoxy-3-methoxyphenyl)methanamine, identified by its CAS number 80365-01-1, is an organic compound characterized by its amine functional group attached to a phenyl ring that is further substituted with ethoxy and methoxy groups. This structure suggests that it may exhibit properties typical of aromatic amines, including potential biological activity due to the presence of the phenolic substituents. The ethoxy and methoxy groups can influence the compound's solubility, polarity, and reactivity, potentially enhancing its lipophilicity and affecting its interaction with biological systems. The presence of these substituents may also contribute to the compound's stability and reactivity under various conditions. Additionally, the compound may be of interest in medicinal chemistry for its potential pharmacological properties, although specific biological activities would require further investigation. Overall, the characteristics of this compound suggest it could be relevant in various chemical and pharmaceutical applications.

Formula: C₁₀H₁₅NO₂

InChI: InChI=1/C10H15NO2/c1-3-13-10-8(7-11)5-4-6-9(10)12-2/h4-6H,3,7,11H2,1-2H3

SMILES: CCOc1c(cccc1OC)CN

Synonyms:

• Benzenemethanamine, 2-Ethoxy-3-Methoxy-
• 1-(2-Ethoxy-3-methoxyphenyl)methanamine