CAS 80368-31-6
:6-hydroxy-5a-methyl-3,9-dimethylidene-2-oxododecahydronaphtho[1,2-b]furan-4-yl (2E)-2-methylbut-2-enoate
Description:
6-Hydroxy-5a-methyl-3,9-dimethylidene-2-oxododecahydronaphtho[1,2-b]furan-4-yl (2E)-2-methylbut-2-enoate is a complex organic compound characterized by its unique structural features, including a fused polycyclic framework and multiple functional groups. The presence of a hydroxyl group indicates potential for hydrogen bonding, which can influence its solubility and reactivity. The dimethylidene and oxo groups contribute to its reactivity, making it a candidate for various chemical transformations. This compound may exhibit interesting biological activities due to its structural complexity, which is typical of many natural products and derivatives. Its ester functionality suggests it could participate in esterification reactions or hydrolysis, impacting its stability and reactivity in different environments. The compound's molecular structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its properties and behavior in various conditions. Overall, this compound exemplifies the intricate nature of organic chemistry and the diverse functionalities that can arise from complex molecular architectures.
Formula:C20H26O5
InChI:InChI=1/C20H26O5/c1-6-10(2)18(22)24-13-9-20(5)14(21)8-7-11(3)16(20)17-15(13)12(4)19(23)25-17/h6,13-17,21H,3-4,7-9H2,1-2,5H3/b10-6+
Synonyms:- 8β-Tigloyloxyreynosin
- 2-Butenoic acid, 2-methyl-, dodecahydro-6-hydroxy-5a-methyl-3,9-bis(methylene)-2-oxonaphtho[1,2-b]furan-4-yl ester, [3aR-[3aα,4β(E),5aβ,6β,9aα,9bβ]]- (9CI)
- NSC357287/8beta-Tigloyloxyreynosin
- 8beta-Tigloyloxyreynosin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
8β-Tigloyloxyreynosin
CAS:8beta-Tigloyloxyreynosin is a natural product for research related to life sciences. The catalog number is TN3306 and the CAS number is 80368-31-6.Formula:C20H26O5Purity:98%Color and Shape:SolidMolecular weight:346.4238β-Tigloyloxyreynosin
CAS:8β-Tigloyloxyreynosin is a sesquiterpene lactone, which is derived from plants, particularly those in the Asteraceae family. This family is known for producing a variety of biologically active compounds with significant pharmacological potential. The mode of action of 8β-Tigloyloxyreynosin involves interactions with various biological pathways, often targeting cellular signaling and metabolic processes. Such compounds are studied for their potential modulatory effects on inflammation and cytotoxicity.Formula:C20H26O5Purity:Min. 95%Molecular weight:346.4 g/mol


