CAS 803687-25-4
:ethyl 3-(3,4-difluorophenyl)propanoate
Description:
Ethyl 3-(3,4-difluorophenyl)propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a propanoate backbone with a phenyl ring that has two fluorine substituents at the 3 and 4 positions, contributing to its unique chemical properties. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its reactivity and stability. Ethyl 3-(3,4-difluorophenyl)propanoate is likely to be a colorless to pale yellow liquid with a pleasant odor, commonly used in organic synthesis and potentially in pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. As with many fluorinated compounds, it may also possess distinct physical properties, such as altered boiling and melting points compared to its non-fluorinated analogs. Safety data should be consulted for handling and usage, as fluorinated compounds can have specific environmental and health considerations.
Formula:C11H12F2O2
InChI:InChI=1/C11H12F2O2/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3,5,7H,2,4,6H2,1H3
SMILES:CCOC(=O)CCc1ccc(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.