CymitQuimica logo

CAS 803712-71-2

:

N-[(5-Bromo-3-methoxy-2H-pyrrol-2-ylidene)methyl]-N-ethylethanamine

Description:
N-[(5-Bromo-3-methoxy-2H-pyrrol-2-ylidene)methyl]-N-ethylethanamine is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a bromine atom and a methoxy group. The presence of the ethyl and methyl amine groups suggests that it may exhibit basic properties, potentially allowing it to interact with various biological targets. The bromine atom can enhance the compound's reactivity and influence its pharmacological profile. This compound may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of neuropharmacology or as a synthetic intermediate. Its molecular structure indicates that it may participate in hydrogen bonding and other intermolecular interactions, which could affect its solubility and bioavailability. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which it is studied. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C10H15BrN2O
InChI:InChI=1S/C10H15BrN2O/c1-4-13(5-2)7-8-9(14-3)6-10(11)12-8/h6-7H,4-5H2,1-3H3
InChI key:InChIKey=KBDKTONRMACOFC-UHFFFAOYSA-N
SMILES:C(N(CC)CC)=C1C(OC)=CC(Br)=N1
Synonyms:
  • N-[(5-Bromo-3-methoxy-2H-pyrrol-2-ylidene)methyl]-N-ethylethanamine
  • Ethanamine, N-[(5-bromo-3-methoxy-2H-pyrrol-2-ylidene)methyl]-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.