CAS 80373-18-8
:3-(4-hydroxyphenyl)propyl acetate
Description:
3-(4-Hydroxyphenyl)propyl acetate, also known by its CAS number 80373-18-8, is an organic compound characterized by its ester functional group. It features a propyl chain attached to a phenolic ring, specifically a para-hydroxyphenyl group, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid with a sweet, fruity odor, making it of interest in flavor and fragrance applications. Its molecular structure allows for potential interactions with biological systems, which may lead to various pharmacological effects. The compound is soluble in organic solvents and has limited solubility in water, reflecting its hydrophobic characteristics. Additionally, it may exhibit antioxidant properties due to the presence of the hydroxy group on the aromatic ring. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 3-(4-hydroxyphenyl)propyl acetate is a versatile compound with applications in both industrial and research settings.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-9(12)14-8-2-3-10-4-6-11(13)7-5-10/h4-7,13H,2-3,8H2,1H3
SMILES:CC(=O)OCCCc1ccc(cc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(4-Hydroxyphenyl)propyl Acetate
CAS:Controlled ProductApplications 3-(4-Hydroxyphenyl)propyl Acetate is an intermediate used in the synthesis of compounds used in biological studies for biodistribution and elimination of xenoestrogen nonylphenol in Wistar rats.
References Shah, M. R., et al.: J. Chem. Soc. Pak., 33, 444 (2011);Formula:C11H14O3Color and Shape:NeatMolecular weight:194.23
