CAS 80373-22-4
:Quinpirole
Description:
Quinpirole is a chemical compound classified as a selective dopamine D2 receptor agonist, primarily used in research settings to study the dopaminergic system and its implications in various neurological and psychiatric disorders. It is a bicyclic compound with a molecular structure that allows it to interact specifically with dopamine receptors, influencing neurotransmission and behavior. Quinpirole is known for its potential effects on locomotor activity and has been utilized in animal models to investigate conditions such as schizophrenia and Parkinson's disease. The compound is typically administered in research contexts, and its pharmacological profile includes both stimulant and sedative properties, depending on the dosage and the specific experimental conditions. As with many research chemicals, safety and handling precautions are essential, as Quinpirole may have side effects or interactions that require careful consideration in experimental designs. Its CAS number, 80373-22-4, is a unique identifier that facilitates the tracking and regulation of this compound in scientific literature and databases.
Formula:C13H21N3
InChI:InChI=1S/C13H21N3/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12/h9-10,13H,2-8H2,1H3,(H,14,15)/t10-,13-/m1/s1
InChI key:InChIKey=FTSUPYGMFAPCFZ-ZWNOBZJWSA-N
SMILES:C(CC)N1[C@]2([C@@](CC3=C(C2)C=NN3)(CCC1)[H])[H]
Synonyms:- (-)-Quinpirole
- (4aR,8aR)-4,4a,5,6,7,8,8a,9-Octahydro-5-propyl-1H-pyrazolo[3,4-g]quinoline
- 1H-Pyrazolo[3,4-g]quinoline, 4,4a,5,6,7,8,8a,9-octahydro-5-propyl-, (4aR,8aR)-
- 1H-Pyrazolo[3,4-g]quinoline, 4,4a,5,6,7,8,8a,9-octahydro-5-propyl-, (4aR-trans)-
- Ly 156258
- Ly-141865
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quinpirole
CAS:Quinpirole is a dopamine D2/D3 receptor agonist.Formula:C13H21N3Color and Shape:SolidMolecular weight:219.33
