CymitQuimica logo

CAS 80387-79-7

:

5-(4-nitrophenyl)thiophene-2-carboxylic acid

Description:
5-(4-Nitrophenyl)thiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group (-COOH) at the 2-position and a para-nitrophenyl group at the 5-position of the thiophene ring. The presence of the nitro group (-NO2) contributes to its electron-withdrawing properties, which can influence the compound's reactivity and solubility. Typically, compounds like this exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the functional groups present. The carboxylic acid group allows for potential hydrogen bonding and can participate in various chemical reactions, such as esterification or amidation. This compound may also exhibit interesting optical and electronic properties, making it of interest in materials science and organic electronics. Its applications could extend to areas such as organic synthesis, pharmaceuticals, or as intermediates in the production of more complex molecules.
Formula:C11H7NO4S
InChI:InChI=1/C11H7NO4S/c13-11(14)10-6-5-9(17-10)7-1-3-8(4-2-7)12(15)16/h1-6H,(H,13,14)
SMILES:c1cc(ccc1c1ccc(C(=O)O)s1)N(=O)=O
Synonyms:
  • 2-Thiophenecarboxylic Acid, 5-(4-Nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.