CymitQuimica logo

CAS 80392-79-6

:

3-Bromo-2,6-difluoropyridine

Description:
3-Bromo-2,6-difluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine and fluorine atoms. The molecular formula of this compound is C5H3BrF2N, indicating the presence of five carbon atoms, three hydrogen atoms, one nitrogen atom, one bromine atom, and two fluorine atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its role in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries, due to its reactivity and ability to serve as a building block for more complex molecules. The presence of halogen substituents, such as bromine and fluorine, can significantly influence the compound's chemical properties, including its reactivity, polarity, and solubility. Additionally, 3-Bromo-2,6-difluoropyridine may exhibit biological activity, making it of interest for research in medicinal chemistry. Proper handling and safety precautions are essential due to the potential hazards associated with halogenated compounds.
Formula:C5H2BrF2N
InChI:InChI=1/C5H2BrF2N/c6-3-1-2-4(7)9-5(3)8/h1-2H
InChI key:GLWVPTDEVHPILQ-UHFFFAOYSA-N
SMILES:c1cc(F)nc(c1Br)F
Synonyms:
  • Pyridine, 3-bromo-2,6-difluoro-
Found 3 products.