CAS 80396-57-2
:methyl (1S,4aS,7R,7aS)-1-(hexopyranosyloxy)-4'-[(1S)-1-({(2E)-3-[4-(hexopyranosyloxy)phenyl]prop-2-enoyl}oxy)ethyl]-5'-oxo-4a,7a-dihydro-1H,5'H-spiro[cyclopenta[c]pyran-7,2'-furan]-4-carboxylate
Description:
The chemical substance with the name "methyl (1S,4aS,7R,7aS)-1-(hexopyranosyloxy)-4'-[(1S)-1-({(2E)-3-[4-(hexopyranosyloxy)phenyl]prop-2-enoyl}oxy)ethyl]-5'-oxo-4a,7a-dihydro-1H,5'H-spiro[cyclopenta[c]pyran-7,2'-furan]-4-carboxylate" and CAS number 80396-57-2 is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, sugars, and aromatic rings. This compound features a spirocyclic framework, indicating a unique three-dimensional arrangement that can influence its biological activity and chemical reactivity. The presence of hexopyranosyl moieties suggests potential interactions with biological systems, particularly in terms of solubility and bioavailability. Additionally, the compound's stereochemistry, denoted by specific configurations at various chiral centers, may play a crucial role in its pharmacological properties. Overall, this substance is likely to exhibit interesting properties that could be explored for applications in medicinal chemistry or as a bioactive agent.
Formula:C36H42O19
InChI:InChI=1/C36H42O19/c1-15(50-23(39)8-5-16-3-6-17(7-4-16)51-34-29(44)27(42)25(40)21(12-37)52-34)19-11-36(55-32(19)47)10-9-18-20(31(46)48-2)14-49-33(24(18)36)54-35-30(45)28(43)26(41)22(13-38)53-35/h3-11,14-15,18,21-22,24-30,33-35,37-38,40-45H,12-13H2,1-2H3/b8-5+/t15-,18+,21?,22?,24+,25?,26?,27?,28?,29?,30?,33-,34?,35?,36+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Protoplumericin A
CAS:Protoplumericin A displays distinct activity against some pathogenic bacteria and fungi.Formula:C36H42O19Purity:98%Color and Shape:SolidMolecular weight:778.71Protoplumericin A
CAS:Protoplumericin A is a natural compound, specifically a type of iridoid, which is derived from the Plumeria species, commonly found in tropical regions. The source of this compound is notably the latex of Plumeria plants, and it is part of a larger group of secondary metabolites that these plants produce.
Formula:C36H42O19Purity:Min. 95%Molecular weight:778.7 g/mol


