CAS 80403-82-3
:3-(3-chloro-1,2-oxazol-5-yl)propanoic acid
Description:
3-(3-Chloro-1,2-oxazol-5-yl)propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety and a chloro-substituted oxazole ring. This compound typically exhibits properties associated with both carboxylic acids and heterocyclic compounds. The presence of the oxazole ring contributes to its potential reactivity, particularly in nucleophilic substitution reactions, while the carboxylic acid group can participate in acid-base reactions and form salts. The chlorine atom in the oxazole ring may influence the compound's polarity and solubility in various solvents. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as intermediates in organic synthesis. As with many chemical substances, safety data should be consulted to understand its handling and toxicity. Overall, 3-(3-chloro-1,2-oxazol-5-yl)propanoic acid represents a versatile compound with diverse chemical properties and potential applications.
Formula:C6H6ClNO3
InChI:InChI=1/C6H6ClNO3/c7-5-3-4(11-8-5)1-2-6(9)10/h3H,1-2H2,(H,9,10)
SMILES:C(CC(=O)O)c1cc(Cl)no1
Synonyms:- 5-Isoxazolepropanoic acid, 3-chloro-
- 3-(3-Chloro-1,2-oxazol-5-yl)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
