CAS 80416-52-0: methyl (1S,4aS,7R,7aS)-1-(beta-D-glucopyranosyloxy)-4'-(1-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}ethyl)-5'-oxo-4a,7a-dihydro-1H,5'H-spiro[cyclopenta[c]pyran-7,2'-furan]-4-carboxylate
Description:The chemical substance with the name "methyl (1S,4aS,7R,7aS)-1-(beta-D-glucopyranosyloxy)-4'-(1-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}ethyl)-5'-oxo-4a,7a-dihydro-1H,5'H-spiro[cyclopenta[c]pyran-7,2'-furan]-4-carboxylate" and CAS number "80416-52-0" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as glucopyranosyl, hydroxyphenyl, and carboxylate moieties. This compound features a spirocyclic framework, indicative of its unique stereochemistry and potential biological activity. The presence of the glucopyranosyl group suggests that it may exhibit properties related to glycosides, potentially influencing its solubility and reactivity. Additionally, the hydroxyphenyl group may contribute to antioxidant properties, while the enoyl moiety could be involved in various chemical reactions, including those related to enzyme interactions. Overall, this compound's structural complexity hints at potential applications in pharmaceuticals or natural product chemistry, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C30H32O14
InChI:InChI=1/C30H32O14/c1-14(41-21(33)8-5-15-3-6-16(32)7-4-15)18-11-30(44-27(18)38)10-9-17-19(26(37)39-2)13-40-28(22(17)30)43-29-25(36)24(35)23(34)20(12-31)42-29/h3-11,13-14,17,20,22-25,28-29,31-32,34-36H,12H2,1-2H3/b8-5+/t14?,17-,20-,22-,23-,24+,25-,28+,29+,30-/m1/s1

13-O-p-Coumaroylplumieride
Ref: BP-SBP01952
Undefined size | To inquire |

13-O-p-Coumaroylplumieride
Ref: TM-TN2618
5mg | 1,519.00 € | ||
1mL*10mM (DMSO) | 1,670.00 € |

Methyl (1S,4aS,7R,7aS)-4'-[(1S)-1-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}ethyl]-5'-oxo-1-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-( hydroxymethyl)oxan-2-yl]oxy}-4a,7a-dihydro-1H,5'H-spiro[cyclopenta[C]pyran-7,2'-furan]-4-carboxylate
Ref: 3D-FDA41652
1mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |