CAS 80428-29-1
:Mafoprazine
Description:
Mafoprazine, identified by its CAS number 80428-29-1, is a chemical compound that belongs to the class of phenothiazines, which are primarily known for their use in psychiatric medications. This substance exhibits properties that suggest it may act as a central nervous system (CNS) agent, potentially influencing neurotransmitter systems. Mafoprazine is characterized by its ability to interact with various receptors, including dopamine and serotonin receptors, which may contribute to its pharmacological effects. The compound is typically studied for its potential therapeutic applications, particularly in the treatment of mood disorders and other psychiatric conditions. Its chemical structure includes a phenothiazine backbone, which is common among many antipsychotic drugs. However, detailed information regarding its specific pharmacokinetics, toxicity, and clinical applications may be limited, as it is not as widely recognized or utilized as other compounds in its class. As with any chemical substance, safety and efficacy are paramount, and further research is essential to fully understand its potential uses and effects.
Formula:C22H28FN3O3
InChI:InChI=1/C22H28FN3O3/c1-17(27)24-18-8-9-21(22(16-18)28-2)29-15-5-10-25-11-13-26(14-12-25)20-7-4-3-6-19(20)23/h3-4,6-9,16H,5,10-15H2,1-2H3,(H,24,27)
SMILES:CC(=Nc1ccc(c(c1)OC)OCCCN1CCN(CC1)c1ccccc1F)O
Synonyms:- Mafoprazine [INN]
- 4'-(3-(4-(o-Fluorophenyl)-1-piperazinyl)propoxy)-m-acetanisidide
- Mafoprazina
- Mafoprazina [Spanish]
- Mafoprazinum
- Mafoprazinum [Latin]
- Unii-D7Uuo54C6N
- N-(4-{3-[4-(2-fluorophenyl)piperazin-1-yl]propoxy}-3-methoxyphenyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Mafoprazine
CAS:Mafoprazine is an experimental psychotropic drug, which is an organic compound synthetically derived from the azapirone family. It functions primarily as a serotonin receptor agonist, specifically targeting the 5-HT1A receptors, while also exhibiting moderate affinity for dopamine and adrenergic receptors. This dual action on neurotransmitter systems is thought to contribute to its therapeutic effects.Formula:C22H28FN3O3Purity:Min. 95%Molecular weight:401.5 g/molMafoprazine
CAS:Mafoprazine, a phenylpiperazine derivative, exhibits varying affinities for neuronal receptors, primarily exerting its antipsychotic effects through blocking D2 receptors and enhancing α-adrenergic activity. It also increases the activity of dopamine metabolites.Formula:C22H28FN3O3Color and Shape:SolidMolecular weight:401.47



