CAS 80440-95-5
:2-Furoyl isothiocyanate
Description:
2-Furoyl isothiocyanate is an organic compound characterized by its furoyl group, which is a five-membered aromatic ring containing an oxygen atom, and an isothiocyanate functional group. This compound typically appears as a colorless to pale yellow liquid with a pungent odor. It is known for its reactivity, particularly in nucleophilic substitution reactions, due to the presence of the isothiocyanate group, which can readily react with amines and alcohols to form thioureas and thiocarbamates, respectively. 2-Furoyl isothiocyanate is soluble in organic solvents such as dichloromethane and ethyl acetate but has limited solubility in water. It is often used in organic synthesis and as a reagent in various chemical reactions, including the preparation of biologically active compounds. Additionally, it may exhibit antimicrobial and anticancer properties, making it of interest in pharmaceutical research. As with many isothiocyanates, it should be handled with care due to its potential irritant effects on skin and mucous membranes.
Formula:C6H3NO2S
InChI:InChI=1/C6H3NO2S/c8-6(7-4-10)5-2-1-3-9-5/h1-3H
SMILES:c1cc(C(=O)N=C=S)oc1
Synonyms:- Furan-2-Carbonyl Isothiocyanate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
