CymitQuimica logo

CAS 80442-78-0

:

Hippuristanol

Description:
Hippuristanol, with the CAS number 80442-78-0, is a chemical compound that belongs to the class of triterpenoids, which are naturally occurring compounds derived from plant sources. It is characterized by its complex structure, featuring multiple rings and functional groups that contribute to its biological activity. Hippuristanol has garnered interest in the field of medicinal chemistry due to its potential therapeutic properties, particularly in the context of cancer research, where it has been studied for its ability to inhibit certain cellular processes. The compound exhibits a range of biological activities, including anti-inflammatory and anti-proliferative effects, making it a subject of investigation for various pharmacological applications. Additionally, hippuristanol's solubility and stability in different solvents can influence its bioavailability and efficacy in biological systems. As with many natural products, its extraction and purification from plant sources can be challenging, necessitating advanced techniques in organic chemistry for its study and application. Overall, hippuristanol represents a promising area of research in the development of new therapeutic agents.
Formula:C28H46O5
InChI:InChI=1S/C28H46O5/c1-15-13-28(33-24(15,2)3)27(6,31)23-21(32-28)12-19-18-8-7-16-11-17(29)9-10-25(16,4)22(18)20(30)14-26(19,23)5/h15-23,29-31H,7-14H2,1-6H3/t15-,16-,17+,18-,19-,20-,21-,22+,23-,25-,26-,27+,28+/m0/s1
InChI key:InChIKey=HPHXKNOXVBFETI-SHCCRYCOSA-N
SMILES:C[C@]1(O)[C@@]2(O[C@@]3([C@]1([C@]4(C)[C@@](C3)([C@]5([C@]([C@@H](O)C4)([C@]6(C)[C@@](CC5)(C[C@H](O)CC6)[H])[H])[H])[H])[H])[H])C[C@H](C)C(C)(C)O2
Synonyms:
  • Furostan-3,11,20-triol, 22,25-epoxy-24-methyl-, (3α,5α,11β,22β,24S)-
  • Hippuristanol
  • (3α,5α,11β,22β,24S)-22,25-Epoxy-24-methylfurostan-3,11,20-triol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.