CAS 804437-65-8
:(2-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone
Description:
The chemical substance known as (2-chlorophenyl)-[2-(1-piperidylmethyl)phenyl]methanone, with the CAS number 804437-65-8, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a piperidine moiety. This compound features a chlorinated phenyl ring, which can influence its reactivity and biological activity. The presence of the piperidyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Typically, such compounds may exhibit properties like lipophilicity, which can affect their solubility and permeability in biological systems. Additionally, the specific arrangement of functional groups can lead to unique pharmacological profiles, potentially making them useful in drug development. However, detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and potential applications in various fields such as pharmaceuticals or agrochemicals. Safety and handling considerations would also be essential due to the presence of chlorine and the potential for biological activity.
Formula:C19H20ClNO
InChI:InChI=1/C19H20ClNO/c20-18-11-5-4-10-17(18)19(22)16-9-3-2-8-15(16)14-21-12-6-1-7-13-21/h2-5,8-11H,1,6-7,12-14H2
SMILES:C1CCN(CC1)Cc1ccccc1C(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.