CAS 80451-04-3
:cecropin A
Description:
Cecropin A is a peptide that belongs to a class of antimicrobial peptides known as cecropins, which are produced by various insects as part of their innate immune response. It is characterized by its amphipathic structure, which allows it to interact with and disrupt microbial membranes, leading to its antimicrobial activity against a range of bacteria and fungi. Cecropin A typically consists of around 37 amino acids and features a high proportion of positively charged residues, contributing to its ability to bind to negatively charged bacterial membranes. This peptide exhibits a broad spectrum of activity, making it a subject of interest for potential therapeutic applications, particularly in the development of new antibiotics. Additionally, cecropin A has been studied for its potential roles in immunomodulation and as a model for designing synthetic antimicrobial agents. Its stability and efficacy in various conditions further enhance its appeal in biomedical research.
Formula:C184H313N53O46
InChI:InChI=1/C184H313N53O46/c1-27-98(16)145(182(282)235-149(102(20)31-5)181(281)218-115(59-39-46-76-187)159(259)206-103(21)152(252)205-92-138(246)237-82-52-65-130(237)173(273)208-106(24)154(254)228-143(96(12)13)176(276)209-107(25)155(255)229-144(97(14)15)177(277)231-142(95(10)11)175(275)204-89-135(243)211-121(66-70-131(193)239)160(260)207-105(23)156(256)236-150(108(26)238)183(283)221-123(68-72-133(195)241)168(268)232-146(99(17)28-2)178(278)210-104(22)153(253)213-114(151(197)251)58-38-45-75-186)227-137(245)91-202-158(258)129(87-140(249)250)226-163(263)120(64-51-81-200-184(198)199)219-179(279)148(101(19)30-4)234-172(272)128(86-134(196)242)225-164(264)122(67-71-132(194)240)212-136(244)90-203-174(274)141(94(8)9)230-166(266)118(62-42-49-79-190)215-165(265)124(69-73-139(247)248)220-180(280)147(100(18)29-3)233-167(267)119(63-43-50-80-191)214-161(261)116(60-40-47-77-188)216-170(270)126(84-109-53-33-32-34-54-109)224-169(269)125(83-93(6)7)223-162(262)117(61-41-48-78-189)217-171(271)127(222-157(257)112(192)56-37-44-74-185)85-110-88-201-113-57-36-35-55-111(110)113/h32-36,53-55,57,88,93-108,112,114-130,141-150,201,238H,27-31,37-52,56,58-87,89-92,185-192H2,1-26H3,(H2,193,239)(H2,194,240)(H2,195,241)(H2,196,242)(H2,197,251)(H,202,258)(H,203,274)(H,204,275)(H,205,252)(H,206,259)(H,207,260)(H,208,273)(H,209,276)(H,210,278)(H,211,243)(H,212,244)(H,213,253)(H,214,261)(H,215,265)(H,216,270)(H,217,271)(H,218,281)(H,219,279)(H,220,280)(H,221,283)(H,222,257)(H,223,262)(H,224,269)(H,225,264)(H,226,263)(H,227,245)(H,228,254)(H,229,255)(H,230,266)(H,231,277)(H,232,268)(H,233,267)(H,234,272)(H,235,282)(H,236,256)(H,247,248)(H,249,250)(H4,198,199,200)/t98-,99-,100-,101-,102-,103-,104-,105-,106-,107-,108+,112-,114-,115-,116-,117-,118-,119-,120-,121-,122-,123-,124-,125-,126-,127-,128-,129-,130-,141-,142-,143-,144-,145-,146-,147-,148-,149-,150-/m0/s1
Synonyms:- H-Lys-Trp-Lys-Leu-Phe-Lys-Lys-Ile-Glu-Lys-Val-Gly-Gln-Asn-Ile-Arg-Asp-Gly-Ile-Ile-Lys-Ala-Gly-Pro-Ala-Val-Ala-Val-Val-Gly-Gln-Ala-Thr-Gln-Ile-Ala-Lys-NH2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cecropin A
CAS:Cecropin A is a 37-residue peptide with antibacterial activity against Escherichia coli, Pseudomonas aeruginosa, Bacillus megaterium and Micrococcus luteus, at micromolar concentrations.Formula:C184H313N53O46Purity:95.1%Color and Shape:WhiteMolecular weight:4003.84Cecropin A
CAS:Formula:C184H313N53O46Purity:≥ 95%Color and Shape:White powderMolecular weight:4003.78Cecropin A
CAS:<p>Cecropin A, a linear 37-residue antimicrobial polypeptide produced by the cecropia moth, has exhibited cytotoxicity in various human cancer cell lines and</p>Formula:C184H313N53O46Purity:96.78%Color and Shape:SolidMolecular weight:4003.78Cecropin A
CAS:<p>Cecropin A is an antimicrobial peptide, which is derived from the immune systems of insects, specifically moths. It displays potent antimicrobial properties through its ability to disrupt bacterial cell membranes, leading to cell lysis and death. This peptide primarily targets Gram-negative bacteria but is also effective against some Gram-positive strains. Cecropin A has garnered significant scientific interest due to its potential applications in developing new antimicrobial agents, particularly in the face of increasing antibiotic resistance. By integrating Cecropin A into therapeutic strategies, researchers aim to broaden the spectrum of antimicrobial options available for use in both clinical and agricultural settings, offering a promising avenue for future drug development.</p>Formula:C184H313N53O46Purity:Min. 95%Molecular weight:4,003.78 g/mol




