CAS 80451-05-4
:cecropin B
Description:
Cecropin B is a peptide that belongs to the class of antimicrobial peptides, specifically derived from the cecropin family found in insects. It is known for its broad-spectrum antimicrobial activity against various bacteria, fungi, and some viruses. Cecropin B typically consists of a sequence of amino acids that contribute to its ability to disrupt microbial cell membranes, leading to cell lysis and death. This peptide exhibits a positive charge, which enhances its interaction with negatively charged bacterial membranes. Additionally, cecropin B is characterized by its relatively small size and amphipathic nature, allowing it to adopt a helical structure in membrane environments. Its role in the innate immune response of insects highlights its potential applications in biotechnology and medicine, particularly in developing new antimicrobial agents. The CAS number 80451-05-4 uniquely identifies this specific peptide, facilitating its recognition in scientific literature and databases. Overall, cecropin B represents a significant area of interest in research focused on natural antimicrobial compounds.
Formula:C176H301N51O42S
InChI:InChI=1/C176H302N52O41S/c1-25-97(15)140(174(269)224-139(96(13)14)168(263)212-113(57-36-43-72-179)155(250)199-101(19)145(240)198-91-134(234)228-79-50-64-128(228)167(262)202-104(22)149(244)225-141(98(16)26-2)171(266)203-105(23)148(243)222-137(94(9)10)169(264)219-123(82-93(7)8)152(247)196-89-132(232)205-119(65-67-135(235)236)156(251)201-102(20)146(241)206-112(56-35-42-71-178)154(249)200-103(21)147(242)215-122(144(187)239)81-92(5)6)221-133(233)90-197-153(248)126(85-129(185)229)217-160(255)118(63-49-78-193-176(190)191)213-172(267)143(100(18)28-4)227-166(261)127(86-130(186)230)218-157(252)111(62-48-77-192-175(188)189)204-131(231)88-195-151(246)121(69-80-270-24)211-159(254)114(58-37-44-73-180)207-161(256)120(66-68-136(237)238)214-173(268)142(99(17)27-3)226-163(258)117(61-40-47-76-183)208-158(253)115(59-38-45-74-181)209-164(259)124(83-106-51-30-29-31-52-106)220-170(265)138(95(11)12)223-162(257)116(60-39-46-75-182)210-165(260)125(216-150(245)109(184)54-34-41-70-177)84-107-87-194-110-55-33-32-53-108(107)110/h29-33,51-53,55,87,92-105,109,111-128,137-143,194H,25-28,34-50,54,56-86,88-91,177-184H2,1-24H3,(H2,185,229)(H2,186,230)(H2,187,239)(H,195,246)(H,196,247)(H,197,248)(H,198,240)(H,199,250)(H,200,249)(H,201,251)(H,202,262)(H,203,266)(H,204,231)(H,205,232)(H,206,241)(H,207,256)(H,208,253)(H,209,259)(H,210,260)(H,211,254)(H,212,263)(H,213,267)(H,214,268)(H,215,242)(H,216,245)(H,217,255)(H,218,252)(H,219,264)(H,220,265)(H,221,233)(H,222,243)(H,223,257)(H,224,269)(H,225,244)(H,226,258)(H,227,261)(H,235,236)(H,237,238)(H4,188,189,192)(H4,190,191,193)/t97-,98-,99-,100-,101-,102-,103-,104-,105-,109-,111-,112-,113-,114-,115-,116-,117-,118-,119-,120-,121-,122-,123-,124-,125-,126-,127-,128-,137-,138-,139-,140-,141-,142-,143-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](C(C)C)C(=N[C@@H](CCCCN)C(=N[C@@H](C)C(=NCC(=O)N1CCC[C@H]1C(=N[C@@H](C)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](C)C(=N[C@@H](C(C)C)C(=N[C@@H](CC(C)C)C(=NCC(=N[C@@H](CCC(=O)O)C(=N[C@@H](C)C(=N[C@@H](CCCCN)C(=N[C@@H](C)C(=N[C@@H](CC(C)C)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN=C([C@H](CC(=N)O)N=C([C@H](CCCNC(=N)N)N=C([C@H]([C@@H](C)CC)N=C([C@H](CC(=N)O)N=C([C@H](CCCNC(=N)N)N=C(CN=C([C@H](CCSC)N=C([C@H](CCCCN)N=C([C@H](CCC(=O)O)N=C([C@H]([C@@H](C)CC)N=C([C@H](CCCCN)N=C([C@H](CCCCN)N=C([C@H](Cc1ccccc1)N=C([C@H](C(C)C)N=C([C@H](CCCCN)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](CCCCN)N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O
Synonyms:- H-Lys-Trp-Lys-Val-Phe-Lys-Lys-Ile-Glu-Lys-Met-Gly-Arg-Asn-Ile-Arg-Asn-Gly-Ile-Val-Lys-Ala-Gly-Pro-Ala-Ile-Ala-Val-Leu-Gly-Glu-Ala-Lys-Ala-Leu-NH2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cecropin B
CAS:Cecropin B is a 35-residue peptide which showed activity against different tumor cell lines.Formula:C176H302N52O41SPurity:> 99%Color and Shape:White PowderMolecular weight:3834.73Cecropin B
CAS:Formula:C176H301N51O42SPurity:≥ 98.0%Color and Shape:White lyophilised powderMolecular weight:3835.65Cecropin B
CAS:<p>Cecropin B is a small antibacterial peptide from the giant silkmoth, Hyalophora cecropia.</p>Formula:C176H302N52O41SPurity:98%Color and Shape:SolidMolecular weight:3834.74Cecropin B
CAS:Formula:C176H302N52O41SPurity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:3834.72Cecropin-B
CAS:<p>Cecropins are a lytic peptide family, originally isolated from Hyalophora cecropia. Cecropin-B is a cationic helical peptide that can form pores, this is believed to be the reason for its such potent lytic activity. Cecropin-B has been shown to be effective against both Gram-positive and Gram-negative bacteria plus numerous cancer cell lines including multidrug-resistant types. The ability to insert into the cell membrane and lead to pore formation is attributed to the amphipathic groups present creating amphipathic regions. The effectiveness of cecropin-B on cancer cells has led to further use of the peptide as a model for potential new anticancer drugs including cyclic cationic forms.</p>Color and Shape:PowderMolecular weight:3,832.3 g/mol






