CymitQuimica logo

CAS 804551-62-0

:

pyrido[5,6-b]pyrazin-7-amine

Description:
Pyrido[5,6-b]pyrazin-7-amine is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, which contribute to its unique chemical properties. This compound typically exhibits a basic nitrogen atom in the amine functional group, influencing its reactivity and potential applications in medicinal chemistry. The presence of multiple nitrogen atoms in its structure can enhance its ability to form hydrogen bonds, making it a candidate for various biological interactions. Pyrido[5,6-b]pyrazin-7-amine may also display interesting electronic properties due to its conjugated system, which can affect its absorption of light and overall stability. It is often studied for its potential use in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, its solubility and stability in different solvents can vary, impacting its utility in various chemical reactions and formulations. Overall, this compound represents a significant interest in the field of organic and medicinal chemistry due to its structural complexity and potential therapeutic applications.
Formula:C7H6N4
InChI:InChI=1/C7H6N4/c8-5-3-6-7(11-4-5)10-2-1-9-6/h1-4H,8H2
SMILES:c1cnc2c(cc(cn2)N)n1
Synonyms:
  • Pyrido[2,3-b]pyrazin-7-amine (9CI)
  • 7-AMINOPYRIDO[2,3-B]PYRAZINE
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.