CAS 80456-55-9
:α-[(4-Chlorophenoxy)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol
Description:
α-[(4-Chlorophenoxy)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol, with CAS number 80456-55-9, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance is characterized by its unique structure, which includes a triazole ring, a chlorophenoxy group, and an alcohol functional group. It is often recognized for its potential applications in agriculture, particularly as a fungicide or herbicide, due to its ability to inhibit specific biological pathways in target organisms. The presence of the chlorophenoxy moiety enhances its biological activity and selectivity. Additionally, the compound's stability and solubility in various solvents can influence its effectiveness in formulations. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with exposure. Overall, this compound exemplifies the diverse functionalities that can be achieved through careful molecular design in the field of agrochemicals.
Formula:C15H20ClN3O2
InChI:InChI=1S/C15H20ClN3O2/c1-14(2,3)15(20,8-19-11-17-10-18-19)9-21-13-6-4-12(16)5-7-13/h4-7,10-11,20H,8-9H2,1-3H3
InChI key:InChIKey=OCQPZTCGZAFWSG-UHFFFAOYSA-N
SMILES:C(CN1C=NC=N1)(COC2=CC=C(Cl)C=C2)(C(C)(C)C)O
Synonyms:- (2R)-1-(4-chlorophenoxy)-3,3-dimethyl-2-(1H-1,2,4-triazol-1-ylmethyl)butan-2-ol
- 1-(4-chlorophenoxy)-3,3-dimethyl-2-(1H-1,2,4-triazol-1-ylmethyl)butan-2-ol
- 1H-1,2,4-Triazole-1-ethanol, α-[(4-chlorophenoxy)methyl]-α-(1,1-dimethylethyl)-
- Bay N 7133
- Vibunazole
- alpha-tert-Butyl-alpha-((4-chlorophenoxy)methyl)-1H-1,2,4-triazol-1-ethanol
- α-[(4-Chlorophenoxy)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Vibunazole
CAS:Vibunazole is an antifungal agent.Formula:C15H20ClN3O2Color and Shape:SolidMolecular weight:309.79

