CAS 80457-74-5

2-(3-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid

Description:

2-(3-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid, with the CAS number 80457-74-5, is a chemical compound characterized by its thiazolidine ring structure, which incorporates both a carboxylic acid and a hydroxyl group on a phenyl ring. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various biochemical applications. The presence of the thiazolidine moiety suggests it may participate in reactions typical of heterocyclic compounds, such as nucleophilic substitutions or cyclization reactions. Additionally, the hydroxyl group can engage in hydrogen bonding, influencing its solubility and reactivity. The compound may also exhibit biological activity, which could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest potential applications in areas such as drug design, where modifications to the thiazolidine framework could lead to novel therapeutic agents. Overall, this compound represents a unique intersection of organic chemistry and potential biological relevance.

Formula: C₁₀H₁₁NO₃S

InChI: InChI=1/C10H11NO3S/c12-7-3-1-2-6(4-7)9-11-8(5-15-9)10(13)14/h1-4,8-9,11-12H,5H2,(H,13,14)

SMILES: c1cc(cc(c1)O)C1NC(CS1)C(=O)O

Synonyms:

• 4-Thiazolidinecarboxylic Acid, 2-(3-Hydroxyphenyl)-

2-(3-Hydroxyphenyl)thiazolidine-4-carboxylic acid

CAS: 80457-74-5

2-(3-Hydroxyphenyl)thiazolidine-4-carboxylic acid

Purity: 95%

Molecular weight: 225.27g/mol

Ref: 54-OR1074889