CAS 80458-29-3
:phi-27
Description:
"Phi-27," with the CAS number 80458-29-3, is a chemical substance that is primarily recognized as a synthetic compound used in various applications, particularly in the field of materials science and polymer chemistry. While specific characteristics may vary based on its formulation and intended use, substances like Phi-27 typically exhibit properties such as stability under a range of temperatures, resistance to degradation, and compatibility with other materials. It may possess unique chemical functionalities that allow it to interact favorably in composite materials or coatings. Additionally, its molecular structure likely contributes to its performance characteristics, such as mechanical strength, flexibility, or thermal resistance. Safety data sheets and regulatory information should be consulted for detailed handling, toxicity, and environmental impact considerations. As with any chemical substance, proper safety protocols should be followed during its use and disposal to mitigate any potential risks.
Formula:C136H216N36O40
InChI:InChI=1/C136H216N36O40/c1-18-73(14)109(111(141)188)171-128(205)92(52-71(10)11)161-132(209)100(64-175)166-121(198)87(42-44-105(182)183)155-122(199)89(49-68(4)5)160-125(202)94(55-79-37-39-81(178)40-38-79)162-118(195)84(35-26-28-46-138)153-117(194)83(34-25-27-45-137)152-112(189)75(16)150-130(207)98(62-173)167-124(201)91(51-70(8)9)159-120(197)86(41-43-102(140)179)151-103(180)60-146-115(192)88(48-67(2)3)157-123(200)90(50-69(6)7)158-119(196)85(36-29-47-145-136(142)143)154-131(208)99(63-174)168-126(203)93(53-77-30-21-19-22-31-77)163-127(204)97(58-107(186)187)164-133(210)101(65-176)169-135(212)110(76(17)177)172-129(206)95(54-78-32-23-20-24-33-78)165-134(211)108(72(12)13)170-104(181)61-147-116(193)96(57-106(184)185)156-113(190)74(15)149-114(191)82(139)56-80-59-144-66-148-80/h19-24,30-33,37-40,59,66-76,82-101,108-110,173-178H,18,25-29,34-36,41-58,60-65,137-139H2,1-17H3,(H2,140,179)(H2,141,188)(H,144,148)(H,146,192)(H,147,193)(H,149,191)(H,150,207)(H,151,180)(H,152,189)(H,153,194)(H,154,208)(H,155,199)(H,156,190)(H,157,200)(H,158,196)(H,159,197)(H,160,202)(H,161,209)(H,162,195)(H,163,204)(H,164,210)(H,165,211)(H,166,198)(H,167,201)(H,168,203)(H,169,212)(H,170,181)(H,171,205)(H,172,206)(H,182,183)(H,184,185)(H,186,187)(H4,142,143,145)/t73-,74-,75-,76+,82-,83-,84-,85-,86-,87-,88-,89-,90-,91-,92-,93-,94-,95-,96-,97-,98-,99-,100-,101-,108-,109-,110-/m0/s1
Synonyms:- PHI-27 (porcine)
- H-His-Ala-Asp-Gly-Val-Phe-Thr-Ser-Asp-Phe-Ser-Arg-Leu-Leu-Gly-Gln-Leu-Ser-Ala-Lys-Lys-Tyr-Leu-Glu-Ser-Leu-Ile-NH2
- Phi, Porcine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
PHI-27 (porcine)
CAS:Porcine intestinal peptide which belongs to the glucagon-secretin family. It exhibits biological activities similar to vasoactive intestinal peptide (VIP) and secretin.Formula:C136H216N36O40Purity:≥ 97%Color and Shape:WhiteMolecular weight:2995.43PHI-27 (porcine)
CAS:PHI-27 (porcine) is a porcine-derived peptide consisting of 27 amino acids, utilized in the identification of peptide hormones and other bioactive peptides [1].Formula:C136H216N36O40Color and Shape:SolidMolecular weight:2995.39PHI, porcine
CAS:Please enquire for more information about PHI, porcine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C136H216N36O40Purity:Min. 95%Molecular weight:2,995.39 g/mol


