
CAS 80470-73-1
:Caprolactone-ethylene oxide triblock copolymer, sru
Description:
Caprolactone-ethylene oxide triblock copolymer, identified by the CAS number 80470-73-1, is a type of thermoplastic elastomer that exhibits a unique combination of properties due to its block copolymer structure. This material typically consists of segments derived from caprolactone, which imparts flexibility and elasticity, and ethylene oxide, which contributes to hydrophilicity and enhances thermal stability. The triblock configuration allows for phase separation, resulting in a material that can exhibit rubber-like behavior while maintaining processability akin to thermoplastics. It is known for its biocompatibility, making it suitable for various applications in the biomedical field, such as drug delivery systems and tissue engineering. Additionally, this copolymer demonstrates good mechanical strength, resistance to environmental stress, and the ability to be processed through conventional thermoplastic methods. Its versatility and favorable properties make it a valuable material in both industrial and medical applications, particularly where a combination of elasticity and durability is required.
Formula:(C6H10O2)n(C6H10O2)n(C2H4O)nC4H10O3
Synonyms:- Caprolactone-ethylene oxide copolymer, triblock SRU
- Poly[oxy(1-oxo-1,6-hexanediyl)], α-(2-hydroxyethyl)-ω-hydroxy-, α,α′-diether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl), triblock
- Polycaprolactone diester with polyethylene glycol
- Caprolactone-ethylene oxide triblock copolymer, sru
- ε-Caprolactone-ethylene oxide triblock copolymer SRU
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Poly[oxy(1-oxo-1,6-hexanediyl)], α-(2-hydroxyethyl)-ω-hydroxy-, α,α′-diether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl), triblock
CAS:Formula:C18H34O8Molecular weight:378.4578
