CAS 80471-69-8

disodium 2',7'-dichloro-3-oxo-spiro[isobenzofuran-1,9'-xanthene]-3',6'-diolate

Description:

Disodium 2',7'-dichloro-3-oxo-spiro[isobenzofuran-1,9'-xanthene]-3',6'-diolate, with the CAS number 80471-69-8, is a synthetic organic compound characterized by its complex structure, which includes a spirocyclic framework. This compound features two chlorine atoms and a diketone functional group, contributing to its unique chemical properties. It is typically used in various applications, including as a dye or pigment due to its vibrant color and stability. The presence of the isobenzofuran and xanthene moieties suggests potential fluorescence properties, making it useful in photonic applications. Additionally, the disodium salt form indicates its solubility in water, which can enhance its applicability in biological systems or as a tracer in analytical chemistry. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, this compound exemplifies the intricate interplay of structure and function in organic chemistry.

Formula: C₂₀H₈Cl₂Na₂O₅

InChI: InChI=1/C20H10Cl2O5.2Na/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20;;/h1-8,23-24H;;/q;2*+1/p-2

SMILES: c1ccc2c(c1)C(=O)OC12c2cc(c(cc2Oc2cc(c(cc12)Cl)O)O)Cl.[Na].[Na]

2',7'-Dichlorofluorescein Sodium Salt

CAS: 3946-85-8, 80471-69-8

Formula: C₂₀H₈Cl₂Na₂O₅

Purity: >98.0%(T)

Color and Shape: Purple to Dark purple to Brown powder to crystal

Molecular weight: 445.16

Ref: 3B-D0424

2,7-Dichlorofluorescein Sodium Salt ,

CAS: 80471-69-8

Formula: C₂₀H₈Cl₂Na₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 445.1601

Ref: IN-DA003G6S

Sodium 2’,7’-Dichloro-3-Oxo-3H-Spiro[Isobenzofuran-1,9’-Xanthene]-3’,6’-Bis(Olate)

CAS: 80471-69-8

Sodium 2’,7’-Dichloro-3-Oxo-3H-Spiro[Isobenzofuran-1,9’-Xanthene]-3’,6’-Bis(Olate)

Purity: 98%

Molecular weight: 445.16g/mol

Ref: 54-OR1014958