CAS 80477-52-7
:N-Benzyl-1,2,3,6-tetrahydropyridine hydrochloride
Description:
N-Benzyl-1,2,3,6-tetrahydropyridine hydrochloride is a chemical compound characterized by its tetrahydropyridine structure, which features a saturated six-membered ring containing one nitrogen atom. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the benzyl group contributes to its lipophilicity, potentially influencing its biological activity and interaction with various receptors. N-Benzyl-1,2,3,6-tetrahydropyridine derivatives have been studied for their potential neuroprotective effects and as precursors in the synthesis of other pharmacologically relevant compounds. The compound's molecular structure allows for various functional modifications, which can lead to a diverse range of derivatives with unique properties. As with many nitrogen-containing heterocycles, it may exhibit interesting reactivity patterns, making it a valuable compound in research and development within the fields of pharmaceuticals and organic chemistry. Safety and handling precautions should be observed due to its classification and potential biological effects.
Formula:C12H16ClN
InChI:InChI=1/C12H15N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1-5,7-8H,6,9-11H2;1H
SMILES:c1ccc(cc1)CN1CC=CCC1.Cl
Synonyms:- 1-Benzyl-1,2,3,6-tetrahydropyridine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

