CymitQuimica logo

CAS 8048-94-0

:

Cinchonan-9-ol, 6′-methoxy-, monohydriodide, (8α,9R)-, mixt. with triiodobismuthine

Description:
Cinchonan-9-ol, 6′-methoxy-, monohydriodide, (8α,9R)-, mixt. with triiodobismuthine, identified by CAS number 8048-94-0, is a complex chemical substance that combines elements of organic chemistry and coordination chemistry. The compound features a cinchona alkaloid backbone, which is known for its medicinal properties, particularly in antimalarial applications. The presence of the methoxy group enhances its solubility and biological activity. The monohydriodide form indicates the presence of one iodide ion per molecule, which may influence its reactivity and stability. The mixture with triiodobismuthine suggests potential applications in medicinal chemistry, possibly as a therapeutic agent or in diagnostic imaging due to the bismuth component. The stereochemistry, indicated by the (8α,9R)- notation, is crucial for its biological activity, as the spatial arrangement of atoms can significantly affect how the molecule interacts with biological targets. Overall, this compound exemplifies the intersection of organic synthesis and pharmacological application, warranting further investigation into its properties and potential uses.
Formula:C20H24N2O2·BiI3·HI
InChI:InChI=1S/C20H24N2O2.Bi.4HI/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;;;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;;4*1H/q;+3;;;;/p-3/t13-,14-,19-,20+;;;;;/m0...../s1
InChI key:InChIKey=NMWSVYJLYUFTPR-YHKMUBIUSA-K
SMILES:[Bi](I)(I)I.[C@@H](O)(C=1C2=C(C=CC(OC)=C2)N=CC1)[C@]3([N@@]4C[C@H](C=C)[C@](C3)(CC4)[H])[H].I
Synonyms:
  • Quinine bismuth iodide
  • Cinchonan-9-ol, 6′-methoxy-, monohydriodide, (8α,9R)-, mixt. with triiodobismuthine
  • Bismuthine, triiodo-, mixt. contg.
  • Bijochinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.