CAS 80480-15-5
:1-(bromoacetyl)pyrene
Description:
1-(Bromoacetyl)pyrene is an organic compound characterized by its pyrene backbone, which is a polycyclic aromatic hydrocarbon. The presence of a bromoacetyl group at the 1-position of the pyrene structure introduces both halogen and carbonyl functionalities, which can significantly influence its reactivity and properties. This compound is typically a solid at room temperature and may exhibit fluorescence due to the pyrene moiety, making it of interest in various applications, including materials science and organic electronics. The bromoacetyl group can participate in nucleophilic substitution reactions, allowing for further functionalization. Additionally, the compound may exhibit moderate solubility in organic solvents, which is common for pyrene derivatives. Its potential uses include serving as an intermediate in organic synthesis or as a probe in biochemical studies. Safety considerations should be taken into account, as halogenated compounds can pose environmental and health risks. Overall, 1-(bromoacetyl)pyrene is a versatile compound with unique chemical properties stemming from its structural features.
Formula:C18H11BrO
InChI:InChI=1/C18H11BrO/c19-10-16(20)14-8-6-13-5-4-11-2-1-3-12-7-9-15(14)18(13)17(11)12/h1-9H,10H2
SMILES:c1cc2ccc3ccc(c4ccc(c1)c2c34)C(=O)CBr
Synonyms:- 1-Bromoacetylpyrene
- Ethanone, 2-bromo-1-(1-pyrenyl)-
- 2-Bromo-1-(Pyren-1-Yl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-1-(pyren-1-yl)ethanone
CAS:Formula:C18H11BrOPurity:96%Color and Shape:SolidMolecular weight:323.18332-Bromo-1-(pyren-1-yl)ethanone
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:323.18899536132811-(Bromoacetyl)pyrene
CAS:Controlled ProductApplications 1-(Bromoacetyl)pyrene is a novel photoinitiator.
Formula:C18H11BrOColor and Shape:NeatMolecular weight:323.1832-Bromo-1-(pyren-1-yl)ethanone
CAS:2-Bromo-1-(pyren-1-yl)ethanone is a fluorescent derivative of the cyclic peptide 2,5-dibromopyrene. It is used in chemical ionization mass spectroscopy for the identification of sodium salts in reaction mixtures. 2-Bromo-1-(pyren-1-yl)ethanone has been found to be an excellent fluorescence detector in clinical studies, and can be used to measure the concentration of human serum proteins. The carbonyl group in the chromatographic column provides a good retention time, which facilitates gravimetric analysis. In vitro assays have shown that the boron atom enhances the potency of this molecule by increasing its stability and preventing degradation by serum enzymes.Formula:C18H11BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:323.18 g/mol




