CymitQuimica logo

CAS 80480-32-6

:

N,N,3,5,5-Pentamethylhexanamide

Description:
N,N,3,5,5-Pentamethylhexanamide is an organic compound characterized by its amide functional group, which is derived from a hexanoic acid with five methyl groups attached to the nitrogen and carbon backbone. This structure contributes to its unique properties, including a relatively high molecular weight and potential for steric hindrance due to the bulky methyl groups. The presence of the amide group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and boiling point. Typically, amides are polar compounds, which can affect their interactions in various chemical environments. N,N,3,5,5-Pentamethylhexanamide may find applications in organic synthesis, as a solvent, or as a reagent in chemical reactions due to its stability and reactivity. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the surrounding conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H23NO
InChI:InChI=1S/C11H23NO/c1-9(8-11(2,3)4)7-10(13)12(5)6/h9H,7-8H2,1-6H3
InChI key:InChIKey=DPBOCZZMRUVIDT-UHFFFAOYSA-N
SMILES:C(C(CC(C)(C)C)C)C(N(C)C)=O
Synonyms:
  • N,N,3,5,5-Pentamethylhexanamide
  • Hexanamide, N,N,3,5,5-pentamethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.