CymitQuimica logo

CAS 80480-43-9

:

N,N′-1,4-Dioxocan-6-ylidenebis[N-(carboxymethyl)glycine]

Description:
N,N′-1,4-Dioxocan-6-ylidenebis[N-(carboxymethyl)glycine], with the CAS number 80480-43-9, is a chemical compound characterized by its complex structure, which includes dioxo and carboxymethyl functional groups. This compound is likely to exhibit properties typical of chelating agents due to the presence of multiple functional groups that can coordinate with metal ions. It may be soluble in polar solvents, given the carboxymethyl groups, which enhance its hydrophilicity. The presence of dioxo groups suggests potential reactivity in various chemical environments, possibly participating in redox reactions. Additionally, the compound may have applications in biochemistry or medicinal chemistry, particularly in the context of metal ion binding or as a potential ligand in coordination chemistry. Its stability, reactivity, and specific applications would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other reactants or metal ions. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C14H22N2O10
InChI:InChI=1S/C14H22N2O10/c17-10(18)5-15(6-11(19)20)14(1-2-25-3-4-26-9-14)16(7-12(21)22)8-13(23)24/h1-9H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
InChI key:InChIKey=HZZOUWBMMWVPTR-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(CC(O)=O)C1(N(CC(O)=O)CC(O)=O)CCOCCOC1
Synonyms:
  • DDTA
  • 1,4-Dioxocane, glycine deriv.
  • N,N′-1,4-Dioxocan-6-ylidenebis[N-(carboxymethyl)glycine]
  • Glycine, N,N′-1,4-dioxocan-6-ylidenebis[N-(carboxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.