CAS 8049-97-6
:Melanins
Description:
Melanins are a group of complex biopolymers that are primarily responsible for pigmentation in various organisms, including humans. They are produced through the oxidative polymerization of phenolic compounds, particularly tyrosine, and are characterized by their dark brown to black color. Melanins are insoluble in water and organic solvents, which contributes to their stability and resistance to degradation. They exhibit a high degree of structural heterogeneity, with variations in molecular weight and composition depending on the source and environmental conditions. Melanins play crucial roles in biological systems, including protection against UV radiation, scavenging of free radicals, and contributing to the coloration of skin, hair, and eyes. Additionally, they have potential applications in various fields, including medicine, cosmetics, and materials science, due to their unique properties such as biocompatibility and antioxidant activity. The CAS number 8049-97-6 specifically refers to a type of melanin, highlighting its significance in both biological and industrial contexts.
Formula:Unspecified
InChI:InChI=1/C18H10N2O4/c1-5-13-9-7(3-19-13)12-10-8(11(9)17(23)15(5)21)4-20-14(10)6(2)16(22)18(12)24/h3-4,19-20H,1-2H3
SMILES:Cc1c2c3c(c[nH]2)c2c4c(c[nH]c4c(C)c(=O)c2=O)c3c(=O)c1=O
Synonyms:- 3,8-Dimethyl-2,7-Dihydrobenzo[1,2,3-Cd:4,5,6-C'D']Diindole-4,5,9,10-Tetrone
- Melanin
- Melanin From Sepia Officinalis
- Melanins
- Melanoids
- MeSH ID: D008543
- Melanines
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Melanin
CAS:Melanin is a multifunctional biotin and a powerful cation chelator with antimicrobial, antioxidant and antiradiation activities.Formula:C18H10N2O4Color and Shape:SolidMolecular weight:318.288Melanin - fungal (Ganoderma lucidum)
CAS:Melanin - fungal (Ganoderma lucidum) is a high-molecular-weight polymer, which is derived from the fruiting body and mycelium of the Ganoderma lucidum mushroom. This compound is a biopolymer formed through the oxidative polymerization of phenolic and/or indolic compounds, a process catalyzed by tyrosinase. The mode of action of this melanin involves its ability to absorb harmful ultraviolet (UV) radiation and scavenge reactive oxygen species (ROS), thereby acting as a potent antioxidant and protective agent.Formula:C18H10N2O4Color and Shape:PowderMolecular weight:318.28 g/molMelanin, from Sepia officinalis
CAS:Melanin is a natural pigment, which is derived from Sepia officinalis, commonly known as the common cuttlefish. This pigment is a complex biopolymer sourced from the ink sac of the cuttlefish, a cephalopod that produces ink as a defense mechanism. The mode of action of melanin involves its unique ability to absorb a broad range of the electromagnetic spectrum, providing effective protection against ultraviolet radiation. Additionally, it exhibits remarkable antioxidant properties due to its free radical scavenging abilities.Formula:C18H10N2O4Molecular weight:318.28 g/molMelanin - insect (Hermetia illucens)
CAS:Melanin is a substance that plays a crucial role in the human body. It is responsible for the color of our hair, skin, and eyes. Melanin acts as a natural sunscreen, protecting our skin from harmful UV radiation. It also helps in the synthesis of vitamin D and acts as an antioxidant, protecting our cells from damage caused by free radicals. Gadolinium-based synthetic melanin has been developed to mimic the natural melanin pigment. This synthetic melanin has various applications in industries such as cosmetics, paints, and plastics. It can be used to create vibrant colors and provide UV protection in these products. Researchers have also discovered that certain natural products can enhance melanogenesis, the process of melanin production in the body. These natural pigments have shown antioxidant properties and can inhibit tyrosinase, an enzyme involved in melanin synthesis. By promoting the production of eumelanin (dark brown/black pigment) and inhibiting pheomelanin (yellow/red pigmentFormula:C18H10N2O4Molecular weight:318.28 g/molMelanin - plant (Osmanthus fragrans)
CAS:Melanin is a substance that plays a crucial role in the human body. It is responsible for the color of our hair, skin, and eyes. Melanin acts as a natural sunscreen, protecting our skin from harmful UV radiation. It also helps in the synthesis of vitamin D and acts as an antioxidant, protecting our cells from damage caused by free radicals. Gadolinium-based synthetic melanin has been developed to mimic the natural melanin pigment. This synthetic melanin has various applications in industries such as cosmetics, paints, and plastics. It can be used to create vibrant colors and provide UV protection in these products. Researchers have also discovered that certain natural products can enhance melanogenesis, the process of melanin production in the body. These natural pigments have shown antioxidant properties and can inhibit tyrosinase, an enzyme involved in melanin synthesis. By promoting the production of eumelanin (dark brown/black pigment) and inhibiting pheomelanin (yellow/red pigmentFormula:C18H10N2O4Molecular weight:318.28 g/molMelanin, synthetic
CAS:Melanin, synthetic, is a bioengineered pigment that mimics the natural biopolymer found in organisms. It is derived from controlled chemical synthesis or microbial processes, designed to replicate the structure and properties of naturally occurring melanin.
Formula:C18H10N2O4Color and Shape:PowderMolecular weight:318.28 g/mol



