CAS 80510-04-9
:1,2-Bis(phosphino)benzene
Description:
1,2-Bis(phosphino)benzene, with the CAS number 80510-04-9, is a bidentate ligand characterized by the presence of two phosphine groups attached to a benzene ring at the 1 and 2 positions. This compound typically exhibits a chelating ability, allowing it to form stable complexes with transition metals, which is valuable in various catalytic applications, including cross-coupling reactions and asymmetric synthesis. The phosphine groups contribute to its electron-donating properties, enhancing the reactivity of metal complexes. Additionally, 1,2-Bis(phosphino)benzene is known for its steric and electronic properties, which can be tuned by modifying the phosphine substituents. The compound is generally stable under ambient conditions but should be handled with care due to the potential toxicity of phosphine derivatives. Its applications extend to organometallic chemistry, where it plays a crucial role in the development of new catalysts and materials. Overall, 1,2-Bis(phosphino)benzene is a significant ligand in coordination chemistry, contributing to advancements in synthetic methodologies.
Formula:C6H8P2
InChI:InChI=1/C6H8P2/c7-5-3-1-2-4-6(5)8/h1-4H,7-8H2
SMILES:c1ccc(c(c1)P)P
Synonyms:- 1,2-Phenylenebisphosphine
- Bisphosphinobenzenecolorlessliq
- Bisphosphinobenzeneinhexane
- Benzene-1,2-Diyldiphosphane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Bis(phosphino)benzene, 98+%
CAS:<p>1,2-Bis(phosphino)benzene, 98+%</p>Formula:C6H4(PH2)2Purity:98+%Color and Shape:colorless liq.Molecular weight:142.081,2-Bis(phosphino)benzene, 98+% (10 wt% in hexanes)
CAS:<p>1,2-Bis(phosphino)benzene, 98+% (10 wt% in hexanes)</p>Formula:C6H4(PH2)2Purity:98+%Color and Shape:colorless liq.Molecular weight:142.081,2-Bis(phosphino)benzene
CAS:<p>Please enquire for more information about 1,2-Bis(phosphino)benzene including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C6H8P2Purity:Min. 95%Molecular weight:142.07 g/mol




