
CAS 80510-05-0
:Euchrestaflavanone A
Description:
Euchrestaflavanone A is a flavonoid compound that belongs to the class of flavanones, which are characterized by a 15-carbon skeleton consisting of two aromatic rings and a heterocyclic ring. This compound is typically derived from plant sources and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Flavonoids like Euchrestaflavanone A often exhibit a range of pharmacological effects, making them of interest in medicinal chemistry and natural product research. The structure of Euchrestaflavanone A includes hydroxyl groups that contribute to its reactivity and interaction with biological systems. Its specific applications and efficacy can vary based on the context of use, including potential therapeutic roles in various health conditions. As with many natural compounds, further research is essential to fully elucidate its mechanisms of action and potential benefits in health and disease.
Formula:C25H28O5
InChI:InChI=1S/C25H28O5/c1-14(2)5-7-16-11-17(8-10-19(16)26)23-13-22(29)24-21(28)12-20(27)18(25(24)30-23)9-6-15(3)4/h5-6,8,10-12,23,26-28H,7,9,13H2,1-4H3/t23-/m0/s1
InChI key:InChIKey=BMIMEYWWZBBDCM-QHCPKHFHSA-N
SMILES:C(C=C(C)C)C1=C2C(C(=O)C[C@H](O2)C3=CC(CC=C(C)C)=C(O)C=C3)=C(O)C=C1O
Synonyms:- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-8-(3-methyl-2-buten-1-yl)-, (2S)-
- (2S)-2,3-Dihydro-5,7-dihydroxy-2-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-8-(3-methyl-2-butenyl)-, (S)-
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-8-(3-methyl-2-butenyl)-, (2S)-
- Euchrestaflavanone A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Euchrestaflavanone A
CAS:Euchrestaflavanone A is a natural flavonoid that inhibits platelet aggregation by downregulating glycoprotein IIb/IIIa (αIIb/β3)-mediated signalling pathways.Formula:C25H28O5Purity:99.66%Color and Shape:SolidMolecular weight:408.49Euchrestaflavanone A
CAS:Euchrestaflavanone A is a naturally occurring flavanone, which is a type of polyphenolic compound. It is sourced from plants, specifically derived from the roots of Euchresta formosana, a species used traditionally in herbal medicine. The mode of action of Euchrestaflavanone A involves its interaction with various molecular pathways, influencing antioxidant activity and modulating enzyme function. It exhibits bioactive properties, including anti-inflammatory, antioxidant, and potential anticancer effects.
Formula:C25H28O5Purity:Min. 95%Molecular weight:408.50 g/molRef: 3D-FDA51005
Discontinued product


