CAS 80510-09-4
:N-cis-Feruloyl tyramine
Description:
N-cis-Feruloyl tyramine, with the CAS number 80510-09-4, is a phenolic compound that belongs to the class of amides. It is derived from the amino acid tyrosine and ferulic acid, featuring a cis configuration in its structure. This compound is characterized by its aromatic properties, which contribute to its potential antioxidant activity. N-cis-Feruloyl tyramine is known for its role in plant defense mechanisms and may exhibit various biological activities, including anti-inflammatory and neuroprotective effects. Its solubility is typically influenced by the presence of hydroxyl groups, which can enhance interactions with polar solvents. The compound is of interest in both food chemistry and pharmacology due to its potential health benefits and applications in functional foods. Research continues to explore its mechanisms of action and efficacy in various therapeutic contexts. Overall, N-cis-Feruloyl tyramine represents a significant area of study within natural product chemistry and its implications for health and disease management.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5-
InChI key:InChIKey=NPNNKDMSXVRADT-UITAMQMPSA-N
SMILES:C(=C\C(NCCC1=CC=C(O)C=C1)=O)\C2=CC(OC)=C(O)C=C2
Synonyms:- (2Z)-3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-2-propenamide
- Z-N-Feruloyltyramine
- 2-Propenamide, 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (Z)-
- 2-Propenamide, 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (2Z)-
- N-cis-Feruloyl tyramine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA00G8CT
1mg171.00€5mg523.00€10mg556.00€25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquireN-cis-Feruloyltyramine
CAS:Formula:C18H19NO4Purity:95%~99%Color and Shape:Cryst.Molecular weight:313.353N-Cis-feruloyltyramine
CAS:N-Cis-feruloyltyramine is a naturally occurring phenolic compound, which is derived from the metabolic pathways of certain plant species. As a product of plant metabolism, it is often found in species known for their phenolic content, which is crucial for the plant’s defense mechanisms. This compound is noted for engaging in various biochemical interactions due to its phenolic structure, which allows it to participate in antioxidant activity, among other functions.Formula:C18H19NO4Purity:Min. 95%Molecular weight:313.3 g/molCis-N-Feruloyltyramine
CAS:Cis-N-Feruloyltyramine is a naturally occurring compound found in various plants that shows cytotoxicity against the P-388 cancer cell line.Formula:C18H19NO4Purity:97.43%Color and Shape:SolidMolecular weight:313.35




