CAS 80514-77-8
:L-Threonine, N-(triphenylmethyl)-, compd. with N-ethylethanamine (1:1)
Description:
L-Threonine, N-(triphenylmethyl)-, compd. with N-ethylethanamine (1:1), identified by CAS number 80514-77-8, is a chemical compound that features a threonine amino acid derivative. This compound is characterized by the presence of a triphenylmethyl (trityl) group, which enhances its stability and solubility in organic solvents. The trityl group is known for its ability to protect functional groups in organic synthesis. The compound also includes N-ethylethanamine, which contributes to its overall structure and properties. Typically, such compounds exhibit characteristics like moderate to high melting points, solubility in polar organic solvents, and potential applications in pharmaceuticals or as intermediates in organic synthesis. The presence of both the amino acid and the amine suggests potential biological activity, making it of interest in biochemical research. However, specific reactivity and stability can vary based on environmental conditions and the presence of other reagents. As with all chemical substances, proper handling and safety measures should be observed due to potential hazards associated with its components.
Formula:C23H23NO3·C4H11N
InChI:InChI=1S/C23H23NO3.C4H11N/c1-17(25)21(22(26)27)24-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;1-3-5-4-2/h2-17,21,24-25H,1H3,(H,26,27);5H,3-4H2,1-2H3/t17-,21+;/m1./s1
InChI key:InChIKey=WYYVJRBSJGUXSL-JKSHRDEXSA-N
SMILES:C(N[C@@H]([C@@H](C)O)C(O)=O)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.N(CC)CC
Synonyms:- Trt-Thr-OH・DEA
- Ethanamine, N-ethyl-, compd. with N-(triphenylmethyl)-L-threonine (1:1)
- L-Threonine, N-(triphenylmethyl)-, compd. with N-ethylethanamine (1:1)
- Trt-Thr-Oh• Dea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
