CAS 805179-70-8
:(4-aminopiperidin-1-yl)acetic acid
Description:
(4-Aminopiperidin-1-yl)acetic acid is an organic compound characterized by its piperidine ring structure, which features an amino group at the 4-position and an acetic acid moiety attached to the nitrogen. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of both the amino and carboxylic acid functional groups, which can engage in hydrogen bonding. Its molecular structure allows it to participate in various chemical reactions, making it a useful intermediate in the synthesis of pharmaceuticals and other organic compounds. The presence of the amino group contributes to its basicity, while the carboxylic acid group imparts acidic properties. This dual functionality can influence its behavior in biological systems, potentially affecting its pharmacological activity. Additionally, (4-aminopiperidin-1-yl)acetic acid may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development.
Formula:C7H14N2O2
InChI:InChI=1/C7H14N2O2/c8-6-1-3-9(4-2-6)5-7(10)11/h6H,1-5,8H2,(H,10,11)
SMILES:C1CN(CCC1N)CC(=O)O
Synonyms:- 1-Piperidineacetic Acid, 4-Amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.