CAS 805180-08-9
:2-(azocan-1-yl)acetic acid
Description:
2-(Azocan-1-yl)acetic acid, identified by its CAS number 805180-08-9, is a chemical compound that features a unique structure combining an azocane ring with an acetic acid functional group. The azocane moiety contributes to its cyclic nature, which can influence its physical and chemical properties, such as solubility and reactivity. This compound may exhibit characteristics typical of both amines and carboxylic acids, including potential hydrogen bonding capabilities due to the presence of the carboxylic acid group. The presence of the azocane ring may also impart specific steric and electronic effects, affecting its interactions with other molecules. As with many organic compounds, its behavior in various solvents, stability under different conditions, and potential biological activity would be of interest in both synthetic and applied chemistry contexts. Further studies would be necessary to elucidate its full range of properties and potential applications in fields such as pharmaceuticals or materials science.
Formula:C9H17NO2
InChI:InChI=1/C9H17NO2/c11-9(12)8-10-6-4-2-1-3-5-7-10/h1-8H2,(H,11,12)
SMILES:C1CCCN(CCC1)CC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
