CAS 80525-15-1
:N-ethyl-6-(methylsulfinyl)-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine
Description:
N-ethyl-6-(methylsulfinyl)-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine, with CAS number 80525-15-1, is a chemical compound that belongs to the class of triazine derivatives. This substance is characterized by its triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. The presence of the ethyl and isopropyl groups contributes to its alkylamine characteristics, while the methylsulfinyl group introduces a sulfoxide functionality, which can influence its reactivity and solubility. This compound may exhibit biological activity, potentially serving as a herbicide or pesticide, given the structural motifs commonly associated with agrochemical applications. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of functional groups. As with many nitrogen-containing compounds, it may participate in hydrogen bonding, affecting its interactions in biological systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C9H17N5OS
InChI:InChI=1/C9H17N5OS/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)16(4)15/h6H,5H2,1-4H3,(H2,10,11,12,13,14)
Synonyms:- 1,3,5-Triazine-2,4-diamine, N-ethyl-N'-(1-methylethyl)-6-(methylsulfinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
