
CAS 805251-29-0
:Lesogaberan
Description:
Lesogaberan is a chemical compound that acts as a selective modulator of the metabotropic glutamate receptor subtype 2 (mGluR2). It is primarily investigated for its potential therapeutic applications in treating various neurological disorders, including anxiety and depression. The compound is characterized by its ability to enhance synaptic transmission and promote neuroprotection, which may contribute to its efficacy in managing mood disorders. Lesogaberan has a specific molecular structure that allows it to interact selectively with mGluR2, leading to a modulation of glutamatergic signaling in the brain. Its pharmacological profile suggests a favorable safety and tolerability profile in preclinical studies, although further clinical trials are necessary to fully establish its therapeutic potential and side effects. As with many investigational compounds, the understanding of Lesogaberan's characteristics continues to evolve with ongoing research, focusing on its mechanism of action, efficacy, and potential applications in clinical settings.
Formula:C3H9FNO2P
InChI:InChI=1S/C3H9FNO2P/c4-3(1-5)2-8(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1
InChI key:InChIKey=LJNUIEQATDYXJH-GSVOUGTGSA-N
SMILES:[C@H](CP(=O)O)(CN)F
Synonyms:- P-[(2R)-3-Amino-2-fluoropropyl]phosphinic acid
- AZD 3355
- Phosphinic acid, P-[(2R)-3-amino-2-fluoropropyl]-
- Phosphinic acid, [(2R)-3-amino-2-fluoropropyl]-
- Lesogaberan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AZD-3355
CAS:AZD-3355, also known as Lesogaberan, is a GABA(B)-receptor agonist reflux inhibitor.Formula:C3H7FNO2PColor and Shape:SolidMolecular weight:139.07
