CymitQuimica logo

CAS 80530-56-9

:

5-Mercapto-2-methoxybenzoic acid

Description:
5-Mercapto-2-methoxybenzoic acid is an organic compound characterized by the presence of a mercapto group (-SH) and a methoxy group (-OCH3) attached to a benzoic acid framework. This compound typically exhibits properties associated with both thiols and carboxylic acids, including potential acidity due to the carboxylic acid group and reactivity due to the thiol group. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the carboxylic acid and methoxy groups. The mercapto group can participate in various chemical reactions, such as oxidation and nucleophilic substitution, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, potentially serving as a ligand in coordination chemistry or as an intermediate in the synthesis of more complex molecules. Its specific applications and behavior would depend on the context of its use, including its interactions with other chemical species. Safety data should be consulted for handling and storage, as thiols can be malodorous and may pose health risks.
Formula:C8H8O3S
InChI:InChI=1S/C8H8O3S/c1-11-7-3-2-5(12)4-6(7)8(9)10/h2-4,12H,1H3,(H,9,10)
InChI key:InChIKey=FNDCOFKQOCGHEI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C=CC(S)=C1
Synonyms:
  • 5-Mercapto-2-methoxybenzoic acid
  • 2-Methoxy-5-sulfanylbenzoic acid
  • Benzoic acid, 5-mercapto-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.