CAS 80531-14-2

2-Acetyl-5-benzofurancarbonitrile

Description:

2-Acetyl-5-benzofurancarbonitrile, with the CAS number 80531-14-2, is an organic compound characterized by its unique structure that combines a benzofuran moiety with an acetyl group and a nitrile functional group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the nitrile group contributes to its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the benzofuran structure imparts specific electronic properties, which can influence the compound's behavior in biological systems. The compound may exhibit interesting pharmacological activities, although detailed studies on its biological effects are necessary to fully understand its potential applications. As with many organic compounds, safety data should be consulted to ensure proper handling and usage, as it may pose health risks if not managed appropriately. Overall, 2-Acetyl-5-benzofurancarbonitrile represents a valuable compound in the field of organic chemistry.

Formula: C₁₁H₇NO₂

InChI: InChI=1S/C11H7NO2/c1-7(13)11-5-9-4-8(6-12)2-3-10(9)14-11/h2-5H,1H3

InChI key: InChIKey=VNCNZKCYQHBSKA-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC=2C(O1)=CC=C(C#N)C2

Synonyms:

• 5-Benzofurancarbonitrile, 2-acetyl-
• 2-Acetyl-1-benzofuran-5-carbonitrile
• 2-Acetyl-5-benzofurancarbonitrile