CAS 80535-73-5

2-Amino-1-(1,3-benzodioxol-5-yl)-1-propanone

Description:

2-Amino-1-(1,3-benzodioxol-5-yl)-1-propanone, also known by its CAS number 80535-73-5, is a chemical compound characterized by its structural features that include an amino group and a propanone moiety attached to a benzodioxole ring. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the amino group and reactivity typical of carbonyl compounds. It is often studied in the context of organic synthesis and medicinal chemistry, given its structural similarity to various bioactive molecules. The presence of the benzodioxole moiety may impart unique pharmacological properties, making it of interest in drug development. Additionally, this compound may exhibit solubility in organic solvents and varying degrees of stability depending on environmental conditions. Safety and handling precautions are essential, as with many organic compounds, to mitigate any potential hazards associated with its use. Overall, 2-Amino-1-(1,3-benzodioxol-5-yl)-1-propanone represents a versatile structure with potential applications in various chemical and pharmaceutical fields.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1S/C10H11NO3/c1-6(11)10(12)7-2-3-8-9(4-7)14-5-13-8/h2-4,6H,5,11H2,1H3

InChI key: InChIKey=XDEZOLVDJWWXRG-UHFFFAOYSA-N

SMILES: C(C(C)N)(=O)C=1C=C2C(=CC1)OCO2

Synonyms:

• 2-Amino-1-(1,3-benzodioxol-5-yl)-1-propanone
• 1-Propanone, 2-amino-1-(1,3-benzodioxol-5-yl)-
• 2-Amino-1-(2H-1,3-benzodioxol-5-yl)propan-1-one