CAS 80538-72-3
:4-acetamidopyridine-3-carboxamide
Description:
4-Acetamidopyridine-3-carboxamide, with the CAS number 80538-72-3, is an organic compound that features a pyridine ring substituted with both an acetamido group and a carboxamide group. This compound typically exhibits characteristics common to amides, such as moderate solubility in polar solvents due to the presence of the amide functional groups, which can engage in hydrogen bonding. The pyridine ring contributes to its aromaticity and can influence its reactivity and interaction with other molecules. The presence of both acetamido and carboxamide functionalities suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point, boiling point, and specific reactivity would depend on the molecular environment and conditions, but it is generally stable under standard laboratory conditions. Overall, 4-acetamidopyridine-3-carboxamide is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C8H9N3O2
InChI:InChI=1/C8H9N3O2/c1-5(12)11-7-2-3-10-4-6(7)8(9)13/h2-4H,1H3,(H2,9,13)(H,10,11,12)
SMILES:CC(=O)N=c1cc[nH]cc1C(=N)O
Synonyms:- 4-Acetamidonicotinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.