CAS 80542-76-3

2-[(2-Aminothiazol-4-yl)carboxymethyleneaminooxy]-2-methylpropionic acid

Description:

2-[(2-Aminothiazol-4-yl)carboxymethyleneaminooxy]-2-methylpropionic acid, with the CAS number 80542-76-3, is a chemical compound characterized by its complex structure that includes a thiazole ring, an amino group, and a carboxymethyleneaminooxy functional group. This compound is typically classified as an amino acid derivative due to the presence of both amino and carboxylic acid functional groups. It exhibits properties such as potential biological activity, which may include antimicrobial or anticancer effects, owing to the thiazole moiety that is often associated with pharmacological properties. The presence of the aminooxy group suggests potential reactivity with carbonyl compounds, making it useful in various synthetic applications. Additionally, its solubility in polar solvents is likely due to the presence of the carboxylic acid group, which can ionize in solution. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and biochemistry.

Formula: C₉H₁₁N₃O₅S

InChI: InChI=1/C9H11N3O5S/c1-9(2,7(15)16)17-12-5(6(13)14)4-3-18-8(10)11-4/h3H,1-2H3,(H2,10,11)(H,13,14)(H,15,16)

SMILES: CC(C)(C(=O)O)ON=C(c1csc(=N)[nH]1)C(=O)O