CAS 80546-88-9
:3-Aminopyrrolidine-3-carboxylic acid
Description:
3-Aminopyrrolidine-3-carboxylic acid, also known by its CAS number 80546-88-9, is an organic compound characterized by a pyrrolidine ring with an amino group and a carboxylic acid functional group attached to the same carbon atom. This structure imparts unique properties, making it a valuable compound in various chemical and pharmaceutical applications. The presence of the amino group allows for potential interactions in biological systems, while the carboxylic acid group contributes to its acidity and reactivity. Typically, this compound is a white to off-white solid, soluble in water and polar organic solvents, which facilitates its use in synthesis and formulation processes. Its chirality may also play a role in its biological activity, making it of interest in medicinal chemistry. Overall, 3-Aminopyrrolidine-3-carboxylic acid is notable for its structural features that enable diverse applications in research and industry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C5H10N2O2
InChI:InChI=1/C5H10N2O2/c6-5(4(8)9)1-2-7-3-5/h7H,1-3,6H2,(H,8,9)
SMILES:C1CNCC1(C(=O)O)N
Synonyms:- 3-Amino-3-pyrrolidinecarboxylic acid
- 3-Pyrrolidinecarboxylic Acid, 3-Amino-
- 3-Aminopyrrolidine-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Aminopyrrolidine-3-Carboxylic Acid
CAS:Formula:C5H10N2O2Purity:97%Color and Shape:SolidMolecular weight:130.14513-Aminopyrrolidine-3-carboxylic acid
CAS:3-Aminopyrrolidine-3-carboxylic acidFormula:C5H10N2O2Purity:97%Molecular weight:130.15Cucurbitin chloride
CAS:Cucurbitin chloride is a useful organic compound for research related to life sciences. The catalog number is T124186 and the CAS number is 80546-88-9.Formula:C5H10N2O2Color and Shape:SolidMolecular weight:130.15Cucurbitin chloride (Standard)
CAS:Cucurbitin chloride (Standard) is a reference standard for research and analysis in studies involving Cucurbitin chloride. Cucurbitin chloride is a useful organic compound for research related to life sciences. The catalog number is T124186 and the CAS number is 80546-88-9.Formula:C5H10N2O2Color and Shape:SolidMolecular weight:130.15Cucurbitin chloride
CAS:Natural alkaloidFormula:C5H10N2O2Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:130.15





