CAS 80547-66-6

3-Amino-5-hydroxy-4-methoxybenzoic acid

Description:

3-Amino-5-hydroxy-4-methoxybenzoic acid, with the CAS number 80547-66-6, is an organic compound that belongs to the class of benzoic acids. It features a benzene ring substituted with an amino group (-NH2), a hydroxyl group (-OH), and a methoxy group (-OCH3), which contribute to its unique chemical properties. This compound is typically characterized by its ability to participate in hydrogen bonding due to the presence of both hydroxyl and amino groups, enhancing its solubility in polar solvents. The methoxy group can influence its reactivity and stability, often making it a subject of interest in medicinal chemistry and organic synthesis. Additionally, the compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest that it could engage in various chemical reactions, including esterification and amination, making it versatile in synthetic applications. Overall, 3-Amino-5-hydroxy-4-methoxybenzoic acid is a compound of interest for both its chemical properties and potential applications in various fields.

Formula: C₈H₉NO₄

InChI: InChI=1S/C8H9NO4/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3,10H,9H2,1H3,(H,11,12)

InChI key: InChIKey=SSIDFDGMYIYYBS-UHFFFAOYSA-N

SMILES: O(C)C1=C(N)C=C(C(O)=O)C=C1O

Synonyms:

• Benzoic acid, 3-amino-5-hydroxy-4-methoxy-
• 3-Amino-5-hydroxy-4-methoxybenzoic acid