CymitQuimica logo

CAS 80547-87-1

:

3-Hydroxy-5-mercapto-4-methoxybenzoic acid

Description:
3-Hydroxy-5-mercapto-4-methoxybenzoic acid, with the CAS number 80547-87-1, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with hydroxyl, mercapto, and methoxy groups. This compound typically exhibits properties associated with both phenolic and thiol functionalities, making it potentially useful in various chemical reactions, including redox processes. The presence of the hydroxyl group contributes to its acidity, while the mercapto group can participate in nucleophilic reactions and form disulfide bonds. The methoxy group enhances the compound's lipophilicity and can influence its reactivity and solubility in organic solvents. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its unique combination of functional groups suggests potential uses in fields such as medicinal chemistry, materials science, and biochemistry. However, specific applications and reactivity would depend on further empirical studies and characterization.
Formula:C8H8O4S
InChI:InChI=1S/C8H8O4S/c1-12-7-5(9)2-4(8(10)11)3-6(7)13/h2-3,9,13H,1H3,(H,10,11)
InChI key:InChIKey=AZIKKAGXVJGGCR-UHFFFAOYSA-N
SMILES:O(C)C1=C(O)C=C(C(O)=O)C=C1S
Synonyms:
  • 3-Hydroxy-5-mercapto-4-methoxybenzoic acid
  • 3-Hydroxy-4-methoxy-5-sulfanylbenzoic acid
  • Benzoic acid, 3-hydroxy-5-mercapto-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.