CAS 80563-43-5

4-ethynyl-4'-pentylbiphenyl

Description:

4-Ethynyl-4'-pentylbiphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethynyl group (-C≡CH) at the para position of one phenyl ring and a pentyl group (-C5H11) at the para position of the other phenyl ring contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit liquid crystalline behavior, making it of interest in materials science, particularly in the development of liquid crystal displays (LCDs). Its molecular structure allows for significant π-π stacking interactions, which can influence its thermal and optical properties. Additionally, the presence of the ethynyl group can enhance the compound's reactivity, making it suitable for further chemical modifications. Overall, 4-ethynyl-4'-pentylbiphenyl is notable for its potential applications in advanced materials and organic electronics due to its distinctive structural features and properties.

Formula: C₁₉H₂₀

InChI: InChI=1/C19H20/c1-3-5-6-7-17-10-14-19(15-11-17)18-12-8-16(4-2)9-13-18/h2,8-15H,3,5-7H2,1H3

SMILES: CCCCCc1ccc(cc1)c1ccc(C#C)cc1

Synonyms:

• 1,1'-Biphenyl, 4-Ethynyl-4'-Pentyl-
• 4-Ethynyl-4'-pentyl-1,1'-biphenyl