CAS 80563-77-5

4-hydroxy-1,2-benzothiazol-3(2H)-one 1,1-dioxide

Description:

4-Hydroxy-1,2-benzothiazol-3(2H)-one 1,1-dioxide, with the CAS number 80563-77-5, is an organic compound characterized by its benzothiazole structure, which features a fused benzene and thiazole ring. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar solvents like water and alcohols. It is known for its potential applications in various fields, including as a dye intermediate and in the synthesis of pharmaceuticals. The presence of the hydroxy and sulfonyl groups contributes to its reactivity and ability to form hydrogen bonds, which can influence its biological activity and interactions with other molecules. Additionally, it may exhibit antioxidant properties, making it of interest in research related to oxidative stress and related health implications. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₇H₅NO₄S

InChI: InChI=1/C7H5NO4S/c9-4-2-1-3-5-6(4)7(10)8-13(5,11)12/h1-3,9H,(H,8,10)

SMILES: c1cc(c2c(c1)S(=O)(=O)N=C2O)O

Synonyms:

• 1,2-Benzisothiazol-3(2H)-one, 4-hydroxy-, 1,1-dioxide
• 4-Hydroxy-1,2-benzothiazol-3(2H)-one 1,1-dioxide

4-Hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione

CAS: 80563-77-5

Formula: C₇H₅NO₄S

Molecular weight: 199.1839

Ref: IN-DA008MAP

4-Hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione

CAS: 80563-77-5

4-Hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione is a versatile building block that can be used for the synthesis of fine chemicals with good quality. It is an intermediate for the production of various pharmaceuticals and research chemicals. 4-Hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione can be used as a reaction component in organic synthesis. The compound reacts with nucleophiles at the 4 position to form new carbon–carbon bonds. This reagent can also be used in metalorganic reactions to produce metal complexes. 4-Hydroxythiadiazole has been shown to react with nitrogen nucleophiles such as amines and amino acids to produce ureas and thioureas respectively.

Formula: C₇H₅NO₄S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 199.18 g/mol

Ref: 3D-FH154298