CAS 80567-67-5
:4,6-Dimethyl-2(3H)-benzothiazolone
Description:
4,6-Dimethyl-2(3H)-benzothiazolone, with the CAS number 80567-67-5, is an organic compound characterized by its benzothiazolone structure, which features a fused benzene and thiazole ring. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including as a dye intermediate and in the synthesis of other organic compounds. It exhibits a range of chemical properties, including solubility in organic solvents, which makes it useful in chemical reactions and formulations. The presence of methyl groups at the 4 and 6 positions of the benzothiazolone ring influences its reactivity and stability. Additionally, this compound may display biological activity, making it of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4,6-Dimethyl-2(3H)-benzothiazolone is a versatile compound with significant relevance in chemical research and industrial applications.
Formula:C9H9NOS
InChI:InChI=1/C9H9NOS/c1-5-3-6(2)8-7(4-5)12-9(11)10-8/h3-4H,1-2H3,(H,10,11)
SMILES:Cc1cc(C)c2c(c1)sc(n2)O
Synonyms:- 2(3H)-Benzothiazolone, 4,6-dimethyl-
- 4,6-Dimethyl-2(3H)-benzothiazolon
- 4,6-Dimethyl-2(3H)-benzothiazolon [German]
- 4,6-dimethyl-1,3-benzothiazol-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.