CymitQuimica logo

CAS 805946-35-4

:

5-[4-(ethylamino)butyl]imidazolidine-2,4-dione

Description:
5-[4-(Ethylamino)butyl]imidazolidine-2,4-dione, with the CAS number 805946-35-4, is a chemical compound characterized by its imidazolidine core structure, which features a five-membered ring containing two nitrogen atoms. This compound is notable for its potential biological activity, often explored in pharmaceutical research. The presence of the ethylamino group and the butyl chain contributes to its hydrophilicity and lipophilicity, influencing its solubility and interaction with biological systems. Imidazolidine derivatives are known for their diverse applications, including roles as intermediates in organic synthesis and potential therapeutic agents. The specific arrangement of functional groups in this compound may impart unique properties, such as enzyme inhibition or receptor modulation, making it a subject of interest in medicinal chemistry. Safety and handling considerations are essential, as with any chemical substance, and proper laboratory protocols should be followed when working with it. Further studies are often required to fully elucidate its pharmacological profile and potential applications.
Formula:C9H17N3O2
InChI:InChI=1/C9H17N3O2/c1-2-10-6-4-3-5-7-8(13)12-9(14)11-7/h7,10H,2-6H2,1H3,(H2,11,12,13,14)
SMILES:CCNCCCCC1C(=NC(=N1)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.